C20H18N2O8 — CID 134851268
triethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate (PubChem CID 134851268) has the molecular formula C20H18N2O8 and a molecular weight of 414.37 g/mol. Its IUPAC name is triethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate.
| Compound Name | triethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
|---|---|
| PubChem CID | 134851268 |
| Molecular Formula | C20H18N2O8 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | triethyl 4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c2c(n1)C(=O)C(=O)c1cc(C(=O)OCC)[nH]c1-2 |
| InChI | InChI=1S/C20H18N2O8/c1-4-28-18(25)9-7-11(19(26)29-5-2)22-15-13(9)14-10(16(23)17(15)24)8-12(21-14)20(27)30-6-3/h7-8,21H,4-6H2,1-3H3 |
| InChIKey | OUYDHQZZKZSNMZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|