About (3S)-3-azidoocta-1,7-diene
(3S)-3-azidoocta-1,7-diene (PubChem CID 134851828) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (3S)-3-azidoocta-1,7-diene.
Molecular Properties
| Compound Name | (3S)-3-azidoocta-1,7-diene |
| PubChem CID | 134851828 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (3S)-3-azidoocta-1,7-diene |
| SMILES | C=CCCC[C@@H](C=C)N=[N+]=[N-] |
| InChI | InChI=1S/C8H13N3/c1-3-5-6-7-8(4-2)10-11-9/h3-4,8H,1-2,5-7H2/t8-/m1/s1 |
| InChIKey | SNKQUECYXFERSM-MRVPVSSYSA-N |
| XLogP | 3.21 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-azidoocta-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-azidoocta-1,7-diene?
The IUPAC name of (3S)-3-azidoocta-1,7-diene (CID 134851828) is (3S)-3-azidoocta-1,7-diene.
What is the SMILES notation for (3S)-3-azidoocta-1,7-diene?
The canonical SMILES for (3S)-3-azidoocta-1,7-diene is C=CCCC[C@@H](C=C)N=[N+]=[N-].
What is the InChIKey of (3S)-3-azidoocta-1,7-diene?
The InChIKey is SNKQUECYXFERSM-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H13N3/c1-3-5-6-7-8(4-2)10-11-9/h3-4,8H,1-2,5-7H2/t8-/m1/s1.
What are the key properties of (3S)-3-azidoocta-1,7-diene?
(3S)-3-azidoocta-1,7-diene has a molecular weight of 151.21 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-azidoocta-1,7-diene is sourced from PubChem (CID 134851828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).