C7H12N4O2 — CID 134851829
(2S,3S,4R,5R)-5-azido-2-ethenylpiperidine-3,4-diol (PubChem CID 134851829) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-azido-2-ethenylpiperidine-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-5-azido-2-ethenylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 134851829 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (2S,3S,4R,5R)-5-azido-2-ethenylpiperidine-3,4-diol |
| SMILES | C=C[C@@H]1NC[C@@H](N=[N+]=[N-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12N4O2/c1-2-4-6(12)7(13)5(3-9-4)10-11-8/h2,4-7,9,12-13H,1,3H2/t4-,5+,6-,7+/m0/s1 |
| InChIKey | RXEYWDAGBKSDBY-BNHYGAARSA-N |
| XLogP | -0.46 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|