C11H11O6- — CID 134851987
(Z)-methoxy-(4-methoxycarbonyl-6a-methylfuro[2,3-b]furan-5-ylidene)methanolate (PubChem CID 134851987) has the molecular formula C11H11O6- and a molecular weight of 239.20 g/mol. Its IUPAC name is (Z)-methoxy-(4-methoxycarbonyl-6a-methylfuro[2,3-b]furan-5-ylidene)methanolate.
| Compound Name | (Z)-methoxy-(4-methoxycarbonyl-6a-methylfuro[2,3-b]furan-5-ylidene)methanolate |
|---|---|
| PubChem CID | 134851987 |
| Molecular Formula | C11H11O6- |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (Z)-methoxy-(4-methoxycarbonyl-6a-methylfuro[2,3-b]furan-5-ylidene)methanolate |
| SMILES | COC(=O)C1=C2C=COC2(C)O/C1=C(/[O-])OC |
| InChI | InChI=1S/C11H12O6/c1-11-6(4-5-16-11)7(9(12)14-2)8(17-11)10(13)15-3/h4-5,13H,1-3H3/p-1/b10-8- |
| InChIKey | NHJYSKSQXUMJMR-NTMALXAHSA-M |
| XLogP | -0.08 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|