C13H14O4 — CID 163888047
(3Z)-3-[(E)-2-ethylpent-2-enylidene]-1H-furo[3,4-c]furan-4,6-dione (PubChem CID 163888047) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (3Z)-3-[(E)-2-ethylpent-2-enylidene]-1H-furo[3,4-c]furan-4,6-dione.
| Compound Name | (3Z)-3-[(E)-2-ethylpent-2-enylidene]-1H-furo[3,4-c]furan-4,6-dione |
|---|---|
| PubChem CID | 163888047 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (3Z)-3-[(E)-2-ethylpent-2-enylidene]-1H-furo[3,4-c]furan-4,6-dione |
| SMILES | CC/C=C(/C=C1\OCC2=C1C(=O)OC2=O)CC |
| InChI | InChI=1S/C13H14O4/c1-3-5-8(4-2)6-10-11-9(7-16-10)12(14)17-13(11)15/h5-6H,3-4,7H2,1-2H3/b8-5+,10-6- |
| InChIKey | PZCWRMQIPYOMAB-QYEKGNEQSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|