C26H37NO4Si — CID 134852475
benzyl N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-yl]carbamate (PubChem CID 134852475) has the molecular formula C26H37NO4Si and a molecular weight of 455.67 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134852475 |
| Molecular Formula | C26H37NO4Si |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | benzyl N-[(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxypent-4-en-2-yl]carbamate |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](CO[Si](C)(C)C(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H37NO4Si/c1-7-24(29-18-21-14-10-8-11-15-21)23(20-31-32(5,6)26(2,3)4)27-25(28)30-19-22-16-12-9-13-17-22/h7-17,23-24H,1,18-20H2,2-6H3,(H,27,28)/t23-,24+/m0/s1 |
| InChIKey | CQIBSNZJPQHYKE-BJKOFHAPSA-N |
| XLogP | 6.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|