C18H23NO2 — CID 134852877
1-cyclohexyl-5-hydroxy-3,5-dimethyl-4-phenylpyrrol-2-one (PubChem CID 134852877) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-cyclohexyl-5-hydroxy-3,5-dimethyl-4-phenylpyrrol-2-one.
| Compound Name | 1-cyclohexyl-5-hydroxy-3,5-dimethyl-4-phenylpyrrol-2-one |
|---|---|
| PubChem CID | 134852877 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-cyclohexyl-5-hydroxy-3,5-dimethyl-4-phenylpyrrol-2-one |
| SMILES | CC1=C(c2ccccc2)C(C)(O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C18H23NO2/c1-13-16(14-9-5-3-6-10-14)18(2,21)19(17(13)20)15-11-7-4-8-12-15/h3,5-6,9-10,15,21H,4,7-8,11-12H2,1-2H3 |
| InChIKey | KRUPZOMMWCXKOU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |