C22H37N3O4 — CID 134852925
methyl 2-[1-[2-[5-(6-isocyanohexanoylamino)pentylamino]-2-oxoethyl]cyclopentyl]acetate (PubChem CID 134852925) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is methyl 2-[1-[2-[5-(6-isocyanohexanoylamino)pentylamino]-2-oxoethyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[1-[2-[5-(6-isocyanohexanoylamino)pentylamino]-2-oxoethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 134852925 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | methyl 2-[1-[2-[5-(6-isocyanohexanoylamino)pentylamino]-2-oxoethyl]cyclopentyl]acetate |
| SMILES | [C-]#[N+]CCCCCC(=O)NCCCCCNC(=O)CC1(CC(=O)OC)CCCC1 |
| InChI | InChI=1S/C22H37N3O4/c1-23-14-8-3-5-11-19(26)24-15-9-4-10-16-25-20(27)17-22(12-6-7-13-22)18-21(28)29-2/h3-18H2,2H3,(H,24,26)(H,25,27) |
| InChIKey | RQCONPPHJNQYQS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|