C28H28N2 — CID 134852972
2-[(1R,2R)-1,2-bis(4-ethylphenyl)-2-pyridin-2-ylethyl]pyridine (PubChem CID 134852972) has the molecular formula C28H28N2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[(1R,2R)-1,2-bis(4-ethylphenyl)-2-pyridin-2-ylethyl]pyridine.
| Compound Name | 2-[(1R,2R)-1,2-bis(4-ethylphenyl)-2-pyridin-2-ylethyl]pyridine |
|---|---|
| PubChem CID | 134852972 |
| Molecular Formula | C28H28N2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[(1R,2R)-1,2-bis(4-ethylphenyl)-2-pyridin-2-ylethyl]pyridine |
| SMILES | CCc1ccc([C@H](c2ccccn2)[C@H](c2ccc(CC)cc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C28H28N2/c1-3-21-11-15-23(16-12-21)27(25-9-5-7-19-29-25)28(26-10-6-8-20-30-26)24-17-13-22(4-2)14-18-24/h5-20,27-28H,3-4H2,1-2H3/t27-,28-/m1/s1 |
| InChIKey | FTNTZGQGOOVFEE-VSGBNLITSA-N |
| XLogP | 6.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |