C15H7BrN6OS — CID 134853154
5-(4-bromophenyl)-10-thia-2,3,4,7,12,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),4,6,11,13,15-hexaen-8-one (PubChem CID 134853154) has the molecular formula C15H7BrN6OS and a molecular weight of 399.23 g/mol. Its IUPAC name is 5-(4-bromophenyl)-10-thia-2,3,4,7,12,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),4,6,11,13,15-hexaen-8-one.
| Compound Name | 5-(4-bromophenyl)-10-thia-2,3,4,7,12,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),4,6,11,13,15-hexaen-8-one |
|---|---|
| PubChem CID | 134853154 |
| Molecular Formula | C15H7BrN6OS |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | 5-(4-bromophenyl)-10-thia-2,3,4,7,12,15-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),4,6,11,13,15-hexaen-8-one |
| SMILES | O=c1nc2c(-c3ccc(Br)cc3)n[nH]n2c2c1sc1nccnc12 |
| InChI | InChI=1S/C15H7BrN6OS/c16-8-3-1-7(2-4-8)9-13-19-14(23)12-11(22(13)21-20-9)10-15(24-12)18-6-5-17-10/h1-6,21H |
| InChIKey | ZIOQKCBTCNQOLI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |