C13H7N5OS — CID 137108434
4-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 137108434) has the molecular formula C13H7N5OS and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 4-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 137108434 |
| Molecular Formula | C13H7N5OS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-pyridin-3-yl-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | O=c1[nH]c(-c2cccnc2)nc2c1sc1nccnc12 |
| InChI | InChI=1S/C13H7N5OS/c19-12-10-8(9-13(20-10)16-5-4-15-9)17-11(18-12)7-2-1-3-14-6-7/h1-6H,(H,17,18,19) |
| InChIKey | BSDUKOOEQUUYRI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |