C27H25NO5 — CID 134853287
2-(2-benzyl-2,4-dihydroxy-5-oxo-3-phenylpyrrol-1-yl)ethyl 2-phenylacetate (PubChem CID 134853287) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-(2-benzyl-2,4-dihydroxy-5-oxo-3-phenylpyrrol-1-yl)ethyl 2-phenylacetate.
| Compound Name | 2-(2-benzyl-2,4-dihydroxy-5-oxo-3-phenylpyrrol-1-yl)ethyl 2-phenylacetate |
|---|---|
| PubChem CID | 134853287 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(2-benzyl-2,4-dihydroxy-5-oxo-3-phenylpyrrol-1-yl)ethyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OCCN1C(=O)C(O)=C(c2ccccc2)C1(O)Cc1ccccc1 |
| InChI | InChI=1S/C27H25NO5/c29-23(18-20-10-4-1-5-11-20)33-17-16-28-26(31)25(30)24(22-14-8-3-9-15-22)27(28,32)19-21-12-6-2-7-13-21/h1-15,30,32H,16-19H2 |
| InChIKey | OMEDTSLQICJPCJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |