C15H16F3N2O5- — CID 134853676
(Z,3S)-3-[benzoyl-(2,2,2-trifluoroethylamino)amino]-1,4-dimethoxy-4-oxobut-1-en-1-olate (PubChem CID 134853676) has the molecular formula C15H16F3N2O5- and a molecular weight of 361.30 g/mol. Its IUPAC name is (Z,3S)-3-[benzoyl-(2,2,2-trifluoroethylamino)amino]-1,4-dimethoxy-4-oxobut-1-en-1-olate.
| Compound Name | (Z,3S)-3-[benzoyl-(2,2,2-trifluoroethylamino)amino]-1,4-dimethoxy-4-oxobut-1-en-1-olate |
|---|---|
| PubChem CID | 134853676 |
| Molecular Formula | C15H16F3N2O5- |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (Z,3S)-3-[benzoyl-(2,2,2-trifluoroethylamino)amino]-1,4-dimethoxy-4-oxobut-1-en-1-olate |
| SMILES | COC(=O)[C@H](/C=C(/[O-])OC)N(NCC(F)(F)F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17F3N2O5/c1-24-12(21)8-11(14(23)25-2)20(19-9-15(16,17)18)13(22)10-6-4-3-5-7-10/h3-8,11,19,21H,9H2,1-2H3/p-1/b12-8-/t11-/m0/s1 |
| InChIKey | DVSATDLXHFYBIH-LCFDYFRESA-M |
| XLogP | 0.59 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|