C9H13IO2 — CID 134854891
(4S)-4-(2-iodoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 134854891) has the molecular formula C9H13IO2 and a molecular weight of 280.11 g/mol. Its IUPAC name is (4S)-4-(2-iodoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (4S)-4-(2-iodoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 134854891 |
| Molecular Formula | C9H13IO2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (4S)-4-(2-iodoethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1CC2C(CC[C@H]2CCI)O1 |
| InChI | InChI=1S/C9H13IO2/c10-4-3-6-1-2-8-7(6)5-9(11)12-8/h6-8H,1-5H2/t6-,7?,8?/m0/s1 |
| InChIKey | QYQKHGQIHKFJMK-KKMMWDRVSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|