C13H26O5Si — CID 134855123
(2R,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-2,3-dihydroxypropanal (PubChem CID 134855123) has the molecular formula C13H26O5Si and a molecular weight of 290.43 g/mol. Its IUPAC name is (2R,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-2,3-dihydroxypropanal.
| Compound Name | (2R,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-2,3-dihydroxypropanal |
|---|---|
| PubChem CID | 134855123 |
| Molecular Formula | C13H26O5Si |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2R,3R)-3-[(2S,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxiran-2-yl]-2,3-dihydroxypropanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)O[C@H]1[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C13H26O5Si/c1-12(2,3)19(5,6)17-8-13(4)11(18-13)10(16)9(15)7-14/h7,9-11,15-16H,8H2,1-6H3/t9-,10+,11-,13-/m0/s1 |
| InChIKey | JHEOGDNAQGIKBW-NOHGZBONSA-N |
| XLogP | 1.09 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|