C11H13ClO3 — CID 134855263
methyl (3aR,7aR)-2-(chloromethyl)-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate (PubChem CID 134855263) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is methyl (3aR,7aR)-2-(chloromethyl)-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate.
| Compound Name | methyl (3aR,7aR)-2-(chloromethyl)-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 134855263 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | methyl (3aR,7aR)-2-(chloromethyl)-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)C1=C(CCl)O[C@@H]2C=CCC[C@H]12 |
| InChI | InChI=1S/C11H13ClO3/c1-14-11(13)10-7-4-2-3-5-8(7)15-9(10)6-12/h3,5,7-8H,2,4,6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | HXJZSNHLDXFULK-JGVFFNPUSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|