C14H16O3 — CID 134855362
methyl (3aR,7aR)-2-but-3-ynyl-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate (PubChem CID 134855362) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (3aR,7aR)-2-but-3-ynyl-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate.
| Compound Name | methyl (3aR,7aR)-2-but-3-ynyl-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 134855362 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | methyl (3aR,7aR)-2-but-3-ynyl-3a,4,5,7a-tetrahydro-1-benzofuran-3-carboxylate |
| SMILES | C#CCCC1=C(C(=O)OC)[C@H]2CCC=C[C@H]2O1 |
| InChI | InChI=1S/C14H16O3/c1-3-4-8-12-13(14(15)16-2)10-7-5-6-9-11(10)17-12/h1,6,9-11H,4-5,7-8H2,2H3/t10-,11+/m0/s1 |
| InChIKey | RFNRTEQGCVJIIE-WDEREUQCSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|