C9H17O+ — CID 134855303
(3S)-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-pyran-6-ylium (PubChem CID 134855303) has the molecular formula C9H17O+ and a molecular weight of 141.23 g/mol. Its IUPAC name is (3S)-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-pyran-6-ylium.
| Compound Name | (3S)-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-pyran-6-ylium |
|---|---|
| PubChem CID | 134855303 |
| Molecular Formula | C9H17O+ |
| Molecular Weight | 141.23 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (3S)-2,3,4,5-tetramethyl-3,4,5,6-tetrahydro-2H-pyran-6-ylium |
| SMILES | CC1[CH+]OC(C)[C@@H](C)C1C |
| InChI | InChI=1S/C9H17O/c1-6-5-10-9(4)8(3)7(6)2/h5-9H,1-4H3/q+1/t6?,7?,8-,9?/m0/s1 |
| InChIKey | CUQSLZVJHNBFDF-HZMRZXPBSA-N |
| XLogP | 2.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|