C18H30O2 — CID 134855335
6a-(1-hydroxy-2-methylheptan-2-yl)-3,4-dimethyl-3a,4,5,6-tetrahydropentalen-1-one (PubChem CID 134855335) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 6a-(1-hydroxy-2-methylheptan-2-yl)-3,4-dimethyl-3a,4,5,6-tetrahydropentalen-1-one.
| Compound Name | 6a-(1-hydroxy-2-methylheptan-2-yl)-3,4-dimethyl-3a,4,5,6-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 134855335 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 6a-(1-hydroxy-2-methylheptan-2-yl)-3,4-dimethyl-3a,4,5,6-tetrahydropentalen-1-one |
| SMILES | CCCCCC(C)(CO)C12CCC(C)C1C(C)=CC2=O |
| InChI | InChI=1S/C18H30O2/c1-5-6-7-9-17(4,12-19)18-10-8-13(2)16(18)14(3)11-15(18)20/h11,13,16,19H,5-10,12H2,1-4H3 |
| InChIKey | RNQNTQRGZKXRLK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|