C7H11N7 — CID 134855520
1-[4-(1,2,4-triazol-4-yl)butyl]tetrazole (PubChem CID 134855520) has the molecular formula C7H11N7 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-[4-(1,2,4-triazol-4-yl)butyl]tetrazole.
| Compound Name | 1-[4-(1,2,4-triazol-4-yl)butyl]tetrazole |
|---|---|
| PubChem CID | 134855520 |
| Molecular Formula | C7H11N7 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-[4-(1,2,4-triazol-4-yl)butyl]tetrazole |
| SMILES | c1nncn1CCCCn1cnnn1 |
| InChI | InChI=1S/C7H11N7/c1(3-13-5-8-9-6-13)2-4-14-7-10-11-12-14/h5-7H,1-4H2 |
| InChIKey | RFLFEDYVCFHLAD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|