C16H19NO2S — CID 134855796
N-[3-(cyclopenten-1-yl)prop-2-ynyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 134855796) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[3-(cyclopenten-1-yl)prop-2-ynyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(cyclopenten-1-yl)prop-2-ynyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 134855796 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[3-(cyclopenten-1-yl)prop-2-ynyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC#CC2=CCCC2)cc1 |
| InChI | InChI=1S/C16H19NO2S/c1-14-9-11-16(12-10-14)20(18,19)17(2)13-5-8-15-6-3-4-7-15/h6,9-12H,3-4,7,13H2,1-2H3 |
| InChIKey | RRPIBIIYNAMASR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|