C11H15ClO6 — CID 134855859
methyl (3aS,4S,5S,7aR)-4-chloro-5-hydroxy-2,2-dimethyl-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 134855859) has the molecular formula C11H15ClO6 and a molecular weight of 278.69 g/mol. Its IUPAC name is methyl (3aS,4S,5S,7aR)-4-chloro-5-hydroxy-2,2-dimethyl-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aS,4S,5S,7aR)-4-chloro-5-hydroxy-2,2-dimethyl-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 134855859 |
| Molecular Formula | C11H15ClO6 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | methyl (3aS,4S,5S,7aR)-4-chloro-5-hydroxy-2,2-dimethyl-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(O)CC(=O)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1Cl |
| InChI | InChI=1S/C11H15ClO6/c1-10(2)17-6-5(13)4-11(15,9(14)16-3)8(12)7(6)18-10/h6-8,15H,4H2,1-3H3/t6-,7-,8-,11+/m0/s1 |
| InChIKey | LCPRTPYCYDTABH-CIOUSYIGSA-N |
| XLogP | -0.01 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|