About methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate
methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate (PubChem CID 134855949) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate.
Molecular Properties
| Compound Name | methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate |
| PubChem CID | 134855949 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate |
| SMILES | COC(=O)C=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C9H8O3/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-6H,1H3 |
| InChIKey | IOZPUDKYVSRMSX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The IUPAC name of methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate (CID 134855949) is methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate.
What is the SMILES notation for methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The canonical SMILES for methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate is COC(=O)C=C1C=CC(=O)C=C1.
What is the InChIKey of methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The InChIKey is IOZPUDKYVSRMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-6H,1H3.
What are the key properties of methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate has a molecular weight of 164.16 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-oxocyclohexa-2,5-dien-1-ylidene)acetate is sourced from PubChem (CID 134855949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).