C12H18O7 — CID 134856630
ethyl 2-[[(3aR,5R,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetate (PubChem CID 134856630) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is ethyl 2-[[(3aR,5R,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(3aR,5R,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 134856630 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | ethyl 2-[[(3aR,5R,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]acetate |
| SMILES | CCOC(=O)CO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@H]1C=O |
| InChI | InChI=1S/C12H18O7/c1-4-15-8(14)6-16-9-7(5-13)17-11-10(9)18-12(2,3)19-11/h5,7,9-11H,4,6H2,1-3H3/t7-,9+,10+,11+/m0/s1 |
| InChIKey | UVCIIUFHPSGFLE-AYHFEMFVSA-N |
| XLogP | 0.01 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|