C15H19NO3 — CID 134856825
methyl (3S,4R)-1-benzyl-5-ethenyl-4-hydroxypyrrolidine-3-carboxylate (PubChem CID 134856825) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl (3S,4R)-1-benzyl-5-ethenyl-4-hydroxypyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-1-benzyl-5-ethenyl-4-hydroxypyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 134856825 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl (3S,4R)-1-benzyl-5-ethenyl-4-hydroxypyrrolidine-3-carboxylate |
| SMILES | C=CC1[C@H](O)[C@@H](C(=O)OC)CN1Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c1-3-13-14(17)12(15(18)19-2)10-16(13)9-11-7-5-4-6-8-11/h3-8,12-14,17H,1,9-10H2,2H3/t12-,13?,14+/m0/s1 |
| InChIKey | XPWQDUWGFQARAL-SMEJFCCLSA-N |
| XLogP | 1.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|