About [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate
[(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate (PubChem CID 134858093) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate.
Molecular Properties
| Compound Name | [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate |
| PubChem CID | 134858093 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate |
| SMILES | C=C[C@H](CCc1ccccc1)OC(=O)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C15H19N3O2/c1-2-14(11-10-13-7-4-3-5-8-13)20-15(19)9-6-12-17-18-16/h2-5,7-8,14H,1,6,9-12H2/t14-/m1/s1 |
| InChIKey | CCQVNLJXZIVKHR-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate?
The IUPAC name of [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate (CID 134858093) is [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate.
What is the SMILES notation for [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate?
The canonical SMILES for [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate is C=C[C@H](CCc1ccccc1)OC(=O)CCCN=[N+]=[N-].
What is the InChIKey of [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate?
The InChIKey is CCQVNLJXZIVKHR-CQSZACIVSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-2-14(11-10-13-7-4-3-5-8-13)20-15(19)9-6-12-17-18-16/h2-5,7-8,14H,1,6,9-12H2/t14-/m1/s1.
What are the key properties of [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate?
[(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate has a molecular weight of 273.34 g/mol, XLogP of 3.81, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-5-phenylpent-1-en-3-yl] 4-azidobutanoate is sourced from PubChem (CID 134858093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).