C10H12N6 — CID 151154204
3,4-diazidobutylbenzene (PubChem CID 151154204) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 3,4-diazidobutylbenzene.
| Compound Name | 3,4-diazidobutylbenzene |
|---|---|
| PubChem CID | 151154204 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 3,4-diazidobutylbenzene |
| SMILES | [N-]=[N+]=NCC(CCc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C10H12N6/c11-15-13-8-10(14-16-12)7-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | MYWKMCFGDUZRLG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|