C16H23N3O2 — CID 20769139
[2-(azidomethyl)-4-phenylbutyl] 2,2-dimethylpropanoate (PubChem CID 20769139) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is [2-(azidomethyl)-4-phenylbutyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(azidomethyl)-4-phenylbutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 20769139 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [2-(azidomethyl)-4-phenylbutyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(CCc1ccccc1)CN=[N+]=[N-] |
| InChI | InChI=1S/C16H23N3O2/c1-16(2,3)15(20)21-12-14(11-18-19-17)10-9-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3 |
| InChIKey | GYWFAASKYZNUSF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|