C20H29N3O3 — CID 57384411
[(2E)-5-azido-2-ethylidene-3-(phenylmethoxymethyl)pentyl] 2,2-dimethylpropanoate (PubChem CID 57384411) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is [(2E)-5-azido-2-ethylidene-3-(phenylmethoxymethyl)pentyl] 2,2-dimethylpropanoate.
| Compound Name | [(2E)-5-azido-2-ethylidene-3-(phenylmethoxymethyl)pentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57384411 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | [(2E)-5-azido-2-ethylidene-3-(phenylmethoxymethyl)pentyl] 2,2-dimethylpropanoate |
| SMILES | C/C=C(/COC(=O)C(C)(C)C)C(CCN=[N+]=[N-])COCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O3/c1-5-17(15-26-19(24)20(2,3)4)18(11-12-22-23-21)14-25-13-16-9-7-6-8-10-16/h5-10,18H,11-15H2,1-4H3/b17-5- |
| InChIKey | GZVFQEZFCBZPFM-ZWSORDCHSA-N |
| XLogP | 5.06 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|