C15H30Si — CID 134858190
2,3-dimethylideneheptyl(triethyl)silane (PubChem CID 134858190) has the molecular formula C15H30Si and a molecular weight of 238.49 g/mol. Its IUPAC name is 2,3-dimethylideneheptyl(triethyl)silane.
| Compound Name | 2,3-dimethylideneheptyl(triethyl)silane |
|---|---|
| PubChem CID | 134858190 |
| Molecular Formula | C15H30Si |
| Molecular Weight | 238.49 g/mol |
| Exact Mass | 238.21 |
| IUPAC Name | 2,3-dimethylideneheptyl(triethyl)silane |
| SMILES | C=C(CCCC)C(=C)C[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H30Si/c1-7-11-12-14(5)15(6)13-16(8-2,9-3)10-4/h5-13H2,1-4H3 |
| InChIKey | QHWGUMBRGRZUCS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|