C12H24Si — CID 134858207
2,3-dimethylideneheptyl(trimethyl)silane (PubChem CID 134858207) has the molecular formula C12H24Si and a molecular weight of 196.41 g/mol. Its IUPAC name is 2,3-dimethylideneheptyl(trimethyl)silane.
| Compound Name | 2,3-dimethylideneheptyl(trimethyl)silane |
|---|---|
| PubChem CID | 134858207 |
| Molecular Formula | C12H24Si |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2,3-dimethylideneheptyl(trimethyl)silane |
| SMILES | C=C(CCCC)C(=C)C[Si](C)(C)C |
| InChI | InChI=1S/C12H24Si/c1-7-8-9-11(2)12(3)10-13(4,5)6/h2-3,7-10H2,1,4-6H3 |
| InChIKey | POYKVNPUGKKBTR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|