C16H24O3 — CID 134858471
4-[2-(oxan-2-yloxy)ethyl]-6-prop-1-en-2-ylcyclohex-3-en-1-one (PubChem CID 134858471) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 4-[2-(oxan-2-yloxy)ethyl]-6-prop-1-en-2-ylcyclohex-3-en-1-one.
| Compound Name | 4-[2-(oxan-2-yloxy)ethyl]-6-prop-1-en-2-ylcyclohex-3-en-1-one |
|---|---|
| PubChem CID | 134858471 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4-[2-(oxan-2-yloxy)ethyl]-6-prop-1-en-2-ylcyclohex-3-en-1-one |
| SMILES | C=C(C)C1CC(CCOC2CCCCO2)=CCC1=O |
| InChI | InChI=1S/C16H24O3/c1-12(2)14-11-13(6-7-15(14)17)8-10-19-16-5-3-4-9-18-16/h6,14,16H,1,3-5,7-11H2,2H3 |
| InChIKey | AWFGRSGIVQJFLE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|