C12H11F3N2O3 — CID 134858691
ethyl (2E)-2-(benzoylhydrazinylidene)-3,3,3-trifluoropropanoate (PubChem CID 134858691) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is ethyl (2E)-2-(benzoylhydrazinylidene)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2E)-2-(benzoylhydrazinylidene)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 134858691 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | ethyl (2E)-2-(benzoylhydrazinylidene)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)/C(=N\NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O3/c1-2-20-11(19)9(12(13,14)15)16-17-10(18)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,17,18)/b16-9+ |
| InChIKey | JPSUHCYTMQNSMI-CXUHLZMHSA-N |
| XLogP | 1.90 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|