C16H26O3 — CID 134859050
methyl (Z)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]pent-2-enoate (PubChem CID 134859050) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl (Z)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]pent-2-enoate.
| Compound Name | methyl (Z)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]pent-2-enoate |
|---|---|
| PubChem CID | 134859050 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | methyl (Z)-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]pent-2-enoate |
| SMILES | CC/C=C(\OC/C=C(\C)CCC=C(C)C)C(=O)OC |
| InChI | InChI=1S/C16H26O3/c1-6-8-15(16(17)18-5)19-12-11-14(4)10-7-9-13(2)3/h8-9,11H,6-7,10,12H2,1-5H3/b14-11+,15-8- |
| InChIKey | IEVWJHASJXJGDX-REXKXQMVSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|