C14H27NO4 — CID 134859662
tert-butyl N-[(2R,3S)-1,3-dihydroxyhexan-2-yl]-N-prop-2-enylcarbamate (PubChem CID 134859662) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-1,3-dihydroxyhexan-2-yl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(2R,3S)-1,3-dihydroxyhexan-2-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 134859662 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | tert-butyl N-[(2R,3S)-1,3-dihydroxyhexan-2-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)[C@H](CO)[C@@H](O)CCC |
| InChI | InChI=1S/C14H27NO4/c1-6-8-12(17)11(10-16)15(9-7-2)13(18)19-14(3,4)5/h7,11-12,16-17H,2,6,8-10H2,1,3-5H3/t11-,12+/m1/s1 |
| InChIKey | OZQBDRAFYSHVHB-NEPJUHHUSA-N |
| XLogP | 1.93 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|