C15H27NO3 — CID 45101555
tert-butyl N-[(4R,5R)-5-hydroxyhept-1-en-4-yl]-N-prop-2-enylcarbamate (PubChem CID 45101555) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is tert-butyl N-[(4R,5R)-5-hydroxyhept-1-en-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(4R,5R)-5-hydroxyhept-1-en-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 45101555 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | tert-butyl N-[(4R,5R)-5-hydroxyhept-1-en-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CC[C@H]([C@H](O)CC)N(CC=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO3/c1-7-10-12(13(17)9-3)16(11-8-2)14(18)19-15(4,5)6/h7-8,12-13,17H,1-2,9-11H2,3-6H3/t12-,13-/m1/s1 |
| InChIKey | KXBWUVSYDHLTOF-CHWSQXEVSA-N |
| XLogP | 3.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|