C14H25NO4 — CID 45101552
tert-butyl N-[(2S,3R)-1,2-dihydroxyhex-5-en-3-yl]-N-prop-2-enylcarbamate (PubChem CID 45101552) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1,2-dihydroxyhex-5-en-3-yl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1,2-dihydroxyhex-5-en-3-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 45101552 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1,2-dihydroxyhex-5-en-3-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CC[C@H]([C@H](O)CO)N(CC=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4/c1-6-8-11(12(17)10-16)15(9-7-2)13(18)19-14(3,4)5/h6-7,11-12,16-17H,1-2,8-10H2,3-5H3/t11-,12-/m1/s1 |
| InChIKey | YFCYCCYQKVJYEP-VXGBXAGGSA-N |
| XLogP | 1.71 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|