C17H29NO4 — CID 25137291
[(3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]hept-6-en-3-yl] acetate (PubChem CID 25137291) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is [(3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]hept-6-en-3-yl] acetate.
| Compound Name | [(3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]hept-6-en-3-yl] acetate |
|---|---|
| PubChem CID | 25137291 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [(3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]hept-6-en-3-yl] acetate |
| SMILES | C=CC[C@@H]([C@H](CC)OC(C)=O)N(CC=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO4/c1-8-11-14(15(10-3)21-13(4)19)18(12-9-2)16(20)22-17(5,6)7/h8-9,14-15H,1-2,10-12H2,3-7H3/t14-,15-/m0/s1 |
| InChIKey | BKLLTTVMQIYTGW-GJZGRUSLSA-N |
| XLogP | 3.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|