C21H35NO4 — CID 11089840
tert-butyl (7Z,10Z)-15-oxo-5-propyl-1-oxa-4-azacyclopentadeca-7,10-diene-4-carboxylate (PubChem CID 11089840) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is tert-butyl (7Z,10Z)-15-oxo-5-propyl-1-oxa-4-azacyclopentadeca-7,10-diene-4-carboxylate.
| Compound Name | tert-butyl (7Z,10Z)-15-oxo-5-propyl-1-oxa-4-azacyclopentadeca-7,10-diene-4-carboxylate |
|---|---|
| PubChem CID | 11089840 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | tert-butyl (7Z,10Z)-15-oxo-5-propyl-1-oxa-4-azacyclopentadeca-7,10-diene-4-carboxylate |
| SMILES | CCCC1C/C=C\C/C=C\CCCC(=O)OCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35NO4/c1-5-13-18-14-11-9-7-6-8-10-12-15-19(23)25-17-16-22(18)20(24)26-21(2,3)4/h6,8-9,11,18H,5,7,10,12-17H2,1-4H3/b8-6-,11-9- |
| InChIKey | OCTODRHLVATCBV-BBDSXROGSA-N |
| XLogP | 5.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|