C12H28O3Si — CID 134859677
(2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol (PubChem CID 134859677) has the molecular formula C12H28O3Si and a molecular weight of 248.44 g/mol. Its IUPAC name is (2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol.
| Compound Name | (2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol |
|---|---|
| PubChem CID | 134859677 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2S,5S)-5-[tert-butyl(dimethyl)silyl]oxyhexane-1,2-diol |
| SMILES | C[C@@H](CC[C@H](O)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O3Si/c1-10(7-8-11(14)9-13)15-16(5,6)12(2,3)4/h10-11,13-14H,7-9H2,1-6H3/t10-,11-/m0/s1 |
| InChIKey | BHONTVONWSWCMW-QWRGUYRKSA-N |
| XLogP | 2.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|