C9H22O6Si — CID 77134629
(2S,3S,4R,5R)-1-trimethylsilylhexane-1,2,3,4,5,6-hexol (PubChem CID 77134629) has the molecular formula C9H22O6Si and a molecular weight of 254.35 g/mol. Its IUPAC name is (2S,3S,4R,5R)-1-trimethylsilylhexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4R,5R)-1-trimethylsilylhexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 77134629 |
| Molecular Formula | C9H22O6Si |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2S,3S,4R,5R)-1-trimethylsilylhexane-1,2,3,4,5,6-hexol |
| SMILES | C[Si](C)(C)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H22O6Si/c1-16(2,3)9(15)8(14)7(13)6(12)5(11)4-10/h5-15H,4H2,1-3H3/t5-,6-,7+,8+,9?/m1/s1 |
| InChIKey | QBPZKJUXNUOPFU-PPRREVKSSA-N |
| XLogP | -2.34 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|