C10H12O2 — CID 134860120
(7-methylcyclohepta-1,3,6-trien-1-yl) acetate (PubChem CID 134860120) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (7-methylcyclohepta-1,3,6-trien-1-yl) acetate.
| Compound Name | (7-methylcyclohepta-1,3,6-trien-1-yl) acetate |
|---|---|
| PubChem CID | 134860120 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (7-methylcyclohepta-1,3,6-trien-1-yl) acetate |
| SMILES | CC(=O)OC1=CC=CCC=C1C |
| InChI | InChI=1S/C10H12O2/c1-8-6-4-3-5-7-10(8)12-9(2)11/h3,5-7H,4H2,1-2H3 |
| InChIKey | SLBMBLKVTLEFFR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |