C10H18O5 — CID 134860235
(1S,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2,3-triol (PubChem CID 134860235) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1S,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2,3-triol.
| Compound Name | (1S,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 134860235 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (1S,2R,3S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2,3-triol |
| SMILES | C=C[C@H](O)[C@@H](O)[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O5/c1-4-6(11)8(12)9(13)7-5-14-10(2,3)15-7/h4,6-9,11-13H,1,5H2,2-3H3/t6-,7+,8+,9+/m0/s1 |
| InChIKey | LTTHPGBLELNIRD-JQCXWYLXSA-N |
| XLogP | -0.59 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|