About (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium
(3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium (PubChem CID 134860241) has the molecular formula C6H5ClNO+
and a molecular weight of 142.56 g/mol. Its IUPAC name is (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium |
| PubChem CID | 134860241 |
| Molecular Formula | C6H5ClNO+ |
| Molecular Weight | 142.56 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium |
| SMILES | [NH2+]=C1C=C(Cl)C=CC1=O |
| InChI | InChI=1S/C6H4ClNO/c7-4-1-2-6(9)5(8)3-4/h1-3,8H/p+1 |
| InChIKey | AMYALYGCOLTBLP-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 42.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.56 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium?
The IUPAC name of (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium (CID 134860241) is (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium.
What is the SMILES notation for (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium?
The canonical SMILES for (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium is [NH2+]=C1C=C(Cl)C=CC1=O.
What is the InChIKey of (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium?
The InChIKey is AMYALYGCOLTBLP-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4ClNO/c7-4-1-2-6(9)5(8)3-4/h1-3,8H/p+1.
What are the key properties of (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium?
(3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium has a molecular weight of 142.56 g/mol, XLogP of -0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)azanium is sourced from PubChem (CID 134860241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).