C7H7NO — CID 130027521
6-imino-3-methylcyclohexa-2,4-dien-1-one (PubChem CID 130027521) has the molecular formula C7H7NO and a molecular weight of 121.14 g/mol. Its IUPAC name is 6-imino-3-methylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-imino-3-methylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 130027521 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 6-imino-3-methylcyclohexa-2,4-dien-1-one |
| SMILES | [H]/N=C1\C=CC(C)=CC1=O |
| InChI | InChI=1S/C7H7NO/c1-5-2-3-6(8)7(9)4-5/h2-4,8H,1H3/b8-6+ |
| InChIKey | CDVINKGJNCODCW-SOFGYWHQSA-N |
| XLogP | 1.09 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|