About 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one
4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 20516822) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one |
| PubChem CID | 20516822 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | [H]/N=C1\C=CC(=O)C(C)=C1C |
| InChI | InChI=1S/C8H9NO/c1-5-6(2)8(10)4-3-7(5)9/h3-4,9H,1-2H3/b9-7+ |
| InChIKey | GWIUBTFOCNRVIS-VQHVLOKHSA-N |
| XLogP | 1.48 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one (CID 20516822) is 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one is [H]/N=C1\C=CC(=O)C(C)=C1C.
What is the InChIKey of 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one?
The InChIKey is GWIUBTFOCNRVIS-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H9NO/c1-5-6(2)8(10)4-3-7(5)9/h3-4,9H,1-2H3/b9-7+.
What are the key properties of 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one?
4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one has a molecular weight of 135.17 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 20516822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).