C8H9NO — CID 20516822
4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 20516822) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 20516822 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 4-imino-2,3-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | [H]/N=C1\C=CC(=O)C(C)=C1C |
| InChI | InChI=1S/C8H9NO/c1-5-6(2)8(10)4-3-7(5)9/h3-4,9H,1-2H3/b9-7+ |
| InChIKey | GWIUBTFOCNRVIS-VQHVLOKHSA-N |
| XLogP | 1.48 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|