C8H8NO+ — CID 134843797
1-(6-iminocyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 134843797) has the molecular formula C8H8NO+ and a molecular weight of 134.16 g/mol. Its IUPAC name is 1-(6-iminocyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(6-iminocyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 134843797 |
| Molecular Formula | C8H8NO+ |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1-(6-iminocyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | [H]/N=C1\[CH+]C=CC=C1C(C)=O |
| InChI | InChI=1S/C8H8NO/c1-6(10)7-4-2-3-5-8(7)9/h2-5,9H,1H3/q+1/b9-8+ |
| InChIKey | ORDAYWQCBJUSSX-CMDGGOBGSA-N |
| XLogP | 1.30 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|