C11H15F2NO — CID 155718511
(E)-7,7-difluoro-6-imino-4-prop-1-enyloct-4-en-3-one (PubChem CID 155718511) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is (E)-7,7-difluoro-6-imino-4-prop-1-enyloct-4-en-3-one.
| Compound Name | (E)-7,7-difluoro-6-imino-4-prop-1-enyloct-4-en-3-one |
|---|---|
| PubChem CID | 155718511 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (E)-7,7-difluoro-6-imino-4-prop-1-enyloct-4-en-3-one |
| SMILES | [H]/N=C(\C=C(/C=CC)C(=O)CC)C(C)(F)F |
| InChI | InChI=1S/C11H15F2NO/c1-4-6-8(9(15)5-2)7-10(14)11(3,12)13/h4,6-7,14H,5H2,1-3H3/b6-4?,8-7+,14-10+ |
| InChIKey | VERJSAWPFNFSFC-BENQUKRZSA-N |
| XLogP | 3.14 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|