C10H11NO — CID 91105970
1-[(4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]ethanone (PubChem CID 91105970) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-[(4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]ethanone.
| Compound Name | 1-[(4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]ethanone |
|---|---|
| PubChem CID | 91105970 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1-[(4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]ethanone |
| SMILES | [H]/N=C1\C=C/C=C\CC=C1C(C)=O |
| InChI | InChI=1S/C10H11NO/c1-8(12)9-6-4-2-3-5-7-10(9)11/h2-3,5-7,11H,4H2,1H3/b3-2-,7-5-,9-6?,11-10+ |
| InChIKey | ZHYOHDGPKVLHSB-QLXJIECISA-N |
| XLogP | 2.04 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|