C11H12F3NO — CID 139425190
(4E)-2,4-dimethyl-5-(2,2,2-trifluoroethanimidoyl)hepta-1,4,6-trien-3-one (PubChem CID 139425190) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is (4E)-2,4-dimethyl-5-(2,2,2-trifluoroethanimidoyl)hepta-1,4,6-trien-3-one.
| Compound Name | (4E)-2,4-dimethyl-5-(2,2,2-trifluoroethanimidoyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 139425190 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (4E)-2,4-dimethyl-5-(2,2,2-trifluoroethanimidoyl)hepta-1,4,6-trien-3-one |
| SMILES | [H]/N=C(C(/C=C)=C(\C)C(=O)C(=C)C)\C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO/c1-5-8(10(15)11(12,13)14)7(4)9(16)6(2)3/h5,15H,1-2H2,3-4H3/b8-7+,15-10- |
| InChIKey | ISLUYFJVWSTZEK-XDOICYCNSA-N |
| XLogP | 3.22 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|